C12H20N4O2S — CID 54895491
[4-(2,6-dimethylpiperidin-1-yl)sulfonyl-2-pyridinyl]hydrazine (PubChem CID 54895491) has the molecular formula C12H20N4O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is [4-(2,6-dimethylpiperidin-1-yl)sulfonyl-2-pyridinyl]hydrazine.
| Compound Name | [4-(2,6-dimethylpiperidin-1-yl)sulfonyl-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 54895491 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | [4-(2,6-dimethylpiperidin-1-yl)sulfonyl-2-pyridinyl]hydrazine |
| SMILES | CC1CCCC(C)N1S(=O)(=O)c1ccnc(NN)c1 |
| InChI | InChI=1S/C12H20N4O2S/c1-9-4-3-5-10(2)16(9)19(17,18)11-6-7-14-12(8-11)15-13/h6-10H,3-5,13H2,1-2H3,(H,14,15) |
| InChIKey | KJVXLPZKCUNSIT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|