C12H19N3O2S — CID 62149622
5-(2,6-dimethylpiperidin-1-yl)sulfonylpyridin-2-amine (PubChem CID 62149622) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 5-(2,6-dimethylpiperidin-1-yl)sulfonylpyridin-2-amine.
| Compound Name | 5-(2,6-dimethylpiperidin-1-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 62149622 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5-(2,6-dimethylpiperidin-1-yl)sulfonylpyridin-2-amine |
| SMILES | CC1CCCC(C)N1S(=O)(=O)c1ccc(N)nc1 |
| InChI | InChI=1S/C12H19N3O2S/c1-9-4-3-5-10(2)15(9)18(16,17)11-6-7-12(13)14-8-11/h6-10H,3-5H2,1-2H3,(H2,13,14) |
| InChIKey | SCBXTIGJPLINLS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |