C23H32N2O3S — CID 99719214
(3R)-N-(1-adamantyl)-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 99719214) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is (3R)-N-(1-adamantyl)-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-(1-adamantyl)-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 99719214 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (3R)-N-(1-adamantyl)-1-(4-methylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@@H](C(=O)NC34CC5CC(CC(C5)C3)C4)C2)cc1 |
| InChI | InChI=1S/C23H32N2O3S/c1-16-4-6-21(7-5-16)29(27,28)25-8-2-3-20(15-25)22(26)24-23-12-17-9-18(13-23)11-19(10-17)14-23/h4-7,17-20H,2-3,8-15H2,1H3,(H,24,26)/t17?,18?,19?,20-,23?/m1/s1 |
| InChIKey | GBJCZVJZHBIBSF-LIPMQLJGSA-N |
| XLogP | 3.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |