C19H18BrCl2N3O4S — CID 2090846
N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide (PubChem CID 2090846) has the molecular formula C19H18BrCl2N3O4S and a molecular weight of 535.25 g/mol. Its IUPAC name is N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide.
| Compound Name | N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 2090846 |
| Molecular Formula | C19H18BrCl2N3O4S |
| Molecular Weight | 535.25 g/mol |
| Exact Mass | 532.96 |
| IUPAC Name | N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H18BrCl2N3O4S/c20-14-6-4-12(5-7-14)18(26)23-24-19(27)13-8-10-25(11-9-13)30(28,29)17-15(21)2-1-3-16(17)22/h1-7,13H,8-11H2,(H,23,26)(H,24,27) |
| InChIKey | BIGGWWHAGKZAAZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|