About N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide
N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide (PubChem CID 2090846) has the molecular formula C19H18BrCl2N3O4S
and a molecular weight of 535.25 g/mol. Its IUPAC name is N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide.
Molecular Properties
| Compound Name | N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide |
| PubChem CID | 2090846 |
| Molecular Formula | C19H18BrCl2N3O4S |
| Molecular Weight | 535.25 g/mol |
| Exact Mass | 532.96 |
| IUPAC Name | N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H18BrCl2N3O4S/c20-14-6-4-12(5-7-14)18(26)23-24-19(27)13-8-10-25(11-9-13)30(28,29)17-15(21)2-1-3-16(17)22/h1-7,13H,8-11H2,(H,23,26)(H,24,27) |
| InChIKey | BIGGWWHAGKZAAZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 535.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide?
The IUPAC name of N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide (CID 2090846) is N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide.
What is the SMILES notation for N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide?
The canonical SMILES for N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide is O=C(NNC(=O)C1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1)c1ccc(Br)cc1.
What is the InChIKey of N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide?
The InChIKey is BIGGWWHAGKZAAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18BrCl2N3O4S/c20-14-6-4-12(5-7-14)18(26)23-24-19(27)13-8-10-25(11-9-13)30(28,29)17-15(21)2-1-3-16(17)22/h1-7,13H,8-11H2,(H,23,26)(H,24,27).
What are the key properties of N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide?
N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide has a molecular weight of 535.25 g/mol, XLogP of 3.62, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-bromobenzoyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carbohydrazide is sourced from PubChem (CID 2090846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).