C26H27ClN2O — CID 45016872
N-benzhydryl-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 45016872) has the molecular formula C26H27ClN2O and a molecular weight of 418.97 g/mol. Its IUPAC name is N-benzhydryl-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-benzhydryl-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45016872 |
| Molecular Formula | C26H27ClN2O |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-benzhydryl-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)C1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H27ClN2O/c27-24-13-11-20(12-14-24)19-29-17-15-23(16-18-29)26(30)28-25(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-14,23,25H,15-19H2,(H,28,30) |
| InChIKey | GQGWROOPMXUFFF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |