C27H27ClN2O2 — CID 41188239
N-[(R)-(4-chlorophenyl)-phenylmethyl]-1-(2-methylbenzoyl)piperidine-4-carboxamide (PubChem CID 41188239) has the molecular formula C27H27ClN2O2 and a molecular weight of 446.98 g/mol. Its IUPAC name is N-[(R)-(4-chlorophenyl)-phenylmethyl]-1-(2-methylbenzoyl)piperidine-4-carboxamide.
| Compound Name | N-[(R)-(4-chlorophenyl)-phenylmethyl]-1-(2-methylbenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41188239 |
| Molecular Formula | C27H27ClN2O2 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[(R)-(4-chlorophenyl)-phenylmethyl]-1-(2-methylbenzoyl)piperidine-4-carboxamide |
| SMILES | Cc1ccccc1C(=O)N1CCC(C(=O)N[C@H](c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H27ClN2O2/c1-19-7-5-6-10-24(19)27(32)30-17-15-22(16-18-30)26(31)29-25(20-8-3-2-4-9-20)21-11-13-23(28)14-12-21/h2-14,22,25H,15-18H2,1H3,(H,29,31)/t25-/m1/s1 |
| InChIKey | WHNLMZJMFGCYTK-RUZDIDTESA-N |
| XLogP | 5.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |