C27H28ClFN2O2 — CID 121427392
N-[(4-chlorophenyl)-(4-fluorophenyl)methyl]-1-(2-phenoxyethyl)piperidine-4-carboxamide (PubChem CID 121427392) has the molecular formula C27H28ClFN2O2 and a molecular weight of 466.98 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-(4-fluorophenyl)methyl]-1-(2-phenoxyethyl)piperidine-4-carboxamide.
| Compound Name | N-[(4-chlorophenyl)-(4-fluorophenyl)methyl]-1-(2-phenoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121427392 |
| Molecular Formula | C27H28ClFN2O2 |
| Molecular Weight | 466.98 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | N-[(4-chlorophenyl)-(4-fluorophenyl)methyl]-1-(2-phenoxyethyl)piperidine-4-carboxamide |
| SMILES | O=C(NC(c1ccc(F)cc1)c1ccc(Cl)cc1)C1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C27H28ClFN2O2/c28-23-10-6-20(7-11-23)26(21-8-12-24(29)13-9-21)30-27(32)22-14-16-31(17-15-22)18-19-33-25-4-2-1-3-5-25/h1-13,22,26H,14-19H2,(H,30,32) |
| InChIKey | RZSHFCXTABKGFJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.98 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |