C33H44ClN3O2 — CID 145107795
(Z)-but-2-ene;N-[(4-chlorophenyl)-pyridin-2-ylmethyl]-1-(3-phenoxypropyl)piperidine-4-carboxamide;ethane (PubChem CID 145107795) has the molecular formula C33H44ClN3O2 and a molecular weight of 550.19 g/mol. Its IUPAC name is (Z)-but-2-ene;N-[(4-chlorophenyl)-pyridin-2-ylmethyl]-1-(3-phenoxypropyl)piperidine-4-carboxamide;ethane.
| Compound Name | (Z)-but-2-ene;N-[(4-chlorophenyl)-pyridin-2-ylmethyl]-1-(3-phenoxypropyl)piperidine-4-carboxamide;ethane |
|---|---|
| PubChem CID | 145107795 |
| Molecular Formula | C33H44ClN3O2 |
| Molecular Weight | 550.19 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | (Z)-but-2-ene;N-[(4-chlorophenyl)-pyridin-2-ylmethyl]-1-(3-phenoxypropyl)piperidine-4-carboxamide;ethane |
| SMILES | C/C=C\C.CC.O=C(NC(c1ccc(Cl)cc1)c1ccccn1)C1CCN(CCCOc2ccccc2)CC1 |
| InChI | InChI=1S/C27H30ClN3O2.C4H8.C2H6/c28-23-12-10-21(11-13-23)26(25-9-4-5-16-29-25)30-27(32)22-14-18-31(19-15-22)17-6-20-33-24-7-2-1-3-8-24;1-3-4-2;1-2/h1-5,7-13,16,22,26H,6,14-15,17-20H2,(H,30,32);3-4H,1-2H3;1-2H3/b;4-3-; |
| InChIKey | USUUVHJFOLMMII-LWFKIUJUSA-N |
| XLogP | 7.73 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.19 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|