C24H30F2N2O2 — CID 68839233
N-(1-adamantyl)-1-[2-(3,4-difluorophenyl)acetyl]piperidine-4-carboxamide (PubChem CID 68839233) has the molecular formula C24H30F2N2O2 and a molecular weight of 416.51 g/mol. Its IUPAC name is N-(1-adamantyl)-1-[2-(3,4-difluorophenyl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-(1-adamantyl)-1-[2-(3,4-difluorophenyl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 68839233 |
| Molecular Formula | C24H30F2N2O2 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | N-(1-adamantyl)-1-[2-(3,4-difluorophenyl)acetyl]piperidine-4-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)C1CCN(C(=O)Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C24H30F2N2O2/c25-20-2-1-15(10-21(20)26)11-22(29)28-5-3-19(4-6-28)23(30)27-24-12-16-7-17(13-24)9-18(8-16)14-24/h1-2,10,16-19H,3-9,11-14H2,(H,27,30) |
| InChIKey | PCRUEFIDOWGMEZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |