C26H33F2N3O3 — CID 55964394
1-(1-adamantyl)-3-[3-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-oxopropyl]urea (PubChem CID 55964394) has the molecular formula C26H33F2N3O3 and a molecular weight of 473.56 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[3-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-oxopropyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[3-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-oxopropyl]urea |
|---|---|
| PubChem CID | 55964394 |
| Molecular Formula | C26H33F2N3O3 |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 1-(1-adamantyl)-3-[3-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-oxopropyl]urea |
| SMILES | O=C(NCCC(=O)N1CCC(C(=O)c2cc(F)ccc2F)CC1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H33F2N3O3/c27-20-1-2-22(28)21(12-20)24(33)19-4-7-31(8-5-19)23(32)3-6-29-25(34)30-26-13-16-9-17(14-26)11-18(10-16)15-26/h1-2,12,16-19H,3-11,13-15H2,(H2,29,30,34) |
| InChIKey | HOJLQGOQILXJAR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |