C20H18F2N2O4S — CID 55845220
1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-2-(4-nitrophenyl)sulfanylethanone (PubChem CID 55845220) has the molecular formula C20H18F2N2O4S and a molecular weight of 420.44 g/mol. Its IUPAC name is 1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-2-(4-nitrophenyl)sulfanylethanone.
| Compound Name | 1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-2-(4-nitrophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 55845220 |
| Molecular Formula | C20H18F2N2O4S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-2-(4-nitrophenyl)sulfanylethanone |
| SMILES | O=C(c1cc(F)ccc1F)C1CCN(C(=O)CSc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C20H18F2N2O4S/c21-14-1-6-18(22)17(11-14)20(26)13-7-9-23(10-8-13)19(25)12-29-16-4-2-15(3-5-16)24(27)28/h1-6,11,13H,7-10,12H2 |
| InChIKey | AYCQKQTUHBDXHT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|