C20H20F2N2O4S — CID 56511454
4-[2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-2-oxoethyl]benzenesulfonamide (PubChem CID 56511454) has the molecular formula C20H20F2N2O4S and a molecular weight of 422.45 g/mol. Its IUPAC name is 4-[2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-2-oxoethyl]benzenesulfonamide.
| Compound Name | 4-[2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56511454 |
| Molecular Formula | C20H20F2N2O4S |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 4-[2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-2-oxoethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CC(=O)N2CCC(C(=O)c3cc(F)ccc3F)CC2)cc1 |
| InChI | InChI=1S/C20H20F2N2O4S/c21-15-3-6-18(22)17(12-15)20(26)14-7-9-24(10-8-14)19(25)11-13-1-4-16(5-2-13)29(23,27)28/h1-6,12,14H,7-11H2,(H2,23,27,28) |
| InChIKey | ZGXODFYVPJGSGN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |