C14H16F2N2O2 — CID 119138730
1-[2-(2,5-difluorophenyl)acetyl]piperidine-4-carboxamide (PubChem CID 119138730) has the molecular formula C14H16F2N2O2 and a molecular weight of 282.29 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(2,5-difluorophenyl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 119138730 |
| Molecular Formula | C14H16F2N2O2 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)acetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)Cc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C14H16F2N2O2/c15-11-1-2-12(16)10(7-11)8-13(19)18-5-3-9(4-6-18)14(17)20/h1-2,7,9H,3-6,8H2,(H2,17,20) |
| InChIKey | YGRJRXYEGFLVHS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |