C16H23ClF2N2O2 — CID 119662837
1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2,5-difluorophenyl)ethanone;hydrochloride (PubChem CID 119662837) has the molecular formula C16H23ClF2N2O2 and a molecular weight of 348.82 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2,5-difluorophenyl)ethanone;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2,5-difluorophenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119662837 |
| Molecular Formula | C16H23ClF2N2O2 |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2,5-difluorophenyl)ethanone;hydrochloride |
| SMILES | Cl.NCCCOC1CCN(C(=O)Cc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C16H22F2N2O2.ClH/c17-13-2-3-15(18)12(10-13)11-16(21)20-7-4-14(5-8-20)22-9-1-6-19;/h2-3,10,14H,1,4-9,11,19H2;1H |
| InChIKey | FVZITKFJHILWCB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|