C17H26Cl2N2O3 — CID 119661557
1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(5-chloro-2-methoxyphenyl)ethanone;hydrochloride (PubChem CID 119661557) has the molecular formula C17H26Cl2N2O3 and a molecular weight of 377.31 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(5-chloro-2-methoxyphenyl)ethanone;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(5-chloro-2-methoxyphenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119661557 |
| Molecular Formula | C17H26Cl2N2O3 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(5-chloro-2-methoxyphenyl)ethanone;hydrochloride |
| SMILES | COc1ccc(Cl)cc1CC(=O)N1CCC(OCCCN)CC1.Cl |
| InChI | InChI=1S/C17H25ClN2O3.ClH/c1-22-16-4-3-14(18)11-13(16)12-17(21)20-8-5-15(6-9-20)23-10-2-7-19;/h3-4,11,15H,2,5-10,12,19H2,1H3;1H |
| InChIKey | XTGUZWIQZSRMKJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|