C17H25Cl3N2O3 — CID 119662031
1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2,4-dichlorophenoxy)propan-1-one;hydrochloride (PubChem CID 119662031) has the molecular formula C17H25Cl3N2O3 and a molecular weight of 411.76 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2,4-dichlorophenoxy)propan-1-one;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2,4-dichlorophenoxy)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119662031 |
| Molecular Formula | C17H25Cl3N2O3 |
| Molecular Weight | 411.76 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2,4-dichlorophenoxy)propan-1-one;hydrochloride |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)N1CCC(OCCCN)CC1.Cl |
| InChI | InChI=1S/C17H24Cl2N2O3.ClH/c1-12(24-16-4-3-13(18)11-15(16)19)17(22)21-8-5-14(6-9-21)23-10-2-7-20;/h3-4,11-12,14H,2,5-10,20H2,1H3;1H |
| InChIKey | GCERHSRFPZLDIO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|