C18H27BrN2O3 — CID 119662092
1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2-bromo-4-methylphenoxy)propan-1-one (PubChem CID 119662092) has the molecular formula C18H27BrN2O3 and a molecular weight of 399.33 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2-bromo-4-methylphenoxy)propan-1-one.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2-bromo-4-methylphenoxy)propan-1-one |
|---|---|
| PubChem CID | 119662092 |
| Molecular Formula | C18H27BrN2O3 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(2-bromo-4-methylphenoxy)propan-1-one |
| SMILES | Cc1ccc(OC(C)C(=O)N2CCC(OCCCN)CC2)c(Br)c1 |
| InChI | InChI=1S/C18H27BrN2O3/c1-13-4-5-17(16(19)12-13)24-14(2)18(22)21-9-6-15(7-10-21)23-11-3-8-20/h4-5,12,14-15H,3,6-11,20H2,1-2H3 |
| InChIKey | KTMONIIXRIHJSL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|