C22H21F2NO2 — CID 55747979
(E)-1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-(4-methylphenyl)prop-2-en-1-one (PubChem CID 55747979) has the molecular formula C22H21F2NO2 and a molecular weight of 369.41 g/mol. Its IUPAC name is (E)-1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55747979 |
| Molecular Formula | C22H21F2NO2 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (E)-1-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-(4-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2CCC(C(=O)c3cc(F)ccc3F)CC2)cc1 |
| InChI | InChI=1S/C22H21F2NO2/c1-15-2-4-16(5-3-15)6-9-21(26)25-12-10-17(11-13-25)22(27)19-14-18(23)7-8-20(19)24/h2-9,14,17H,10-13H2,1H3/b9-6+ |
| InChIKey | SKYYEEFNOAACIK-RMKNXTFCSA-N |
| XLogP | 4.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|