C21H21ClF2N2O2 — CID 55841846
N-(2-chloro-4-methylphenyl)-2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]acetamide (PubChem CID 55841846) has the molecular formula C21H21ClF2N2O2 and a molecular weight of 406.86 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]acetamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55841846 |
| Molecular Formula | C21H21ClF2N2O2 |
| Molecular Weight | 406.86 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCC(C(=O)c3cc(F)ccc3F)CC2)c(Cl)c1 |
| InChI | InChI=1S/C21H21ClF2N2O2/c1-13-2-5-19(17(22)10-13)25-20(27)12-26-8-6-14(7-9-26)21(28)16-11-15(23)3-4-18(16)24/h2-5,10-11,14H,6-9,12H2,1H3,(H,25,27) |
| InChIKey | XLWRAEJVQHRODY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |