C23H24F2N2O4S — CID 55963625
4-[(E)-3-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-oxoprop-1-enyl]-N-ethylbenzenesulfonamide (PubChem CID 55963625) has the molecular formula C23H24F2N2O4S and a molecular weight of 462.52 g/mol. Its IUPAC name is 4-[(E)-3-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-oxoprop-1-enyl]-N-ethylbenzenesulfonamide.
| Compound Name | 4-[(E)-3-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-oxoprop-1-enyl]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55963625 |
| Molecular Formula | C23H24F2N2O4S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 4-[(E)-3-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-3-oxoprop-1-enyl]-N-ethylbenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(/C=C/C(=O)N2CCC(C(=O)c3cc(F)ccc3F)CC2)cc1 |
| InChI | InChI=1S/C23H24F2N2O4S/c1-2-26-32(30,31)19-7-3-16(4-8-19)5-10-22(28)27-13-11-17(12-14-27)23(29)20-15-18(24)6-9-21(20)25/h3-10,15,17,26H,2,11-14H2,1H3/b10-5+ |
| InChIKey | WSZUTXFESFZVFK-BJMVGYQFSA-N |
| XLogP | 3.40 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|