C14H16F2O — CID 55120292
(2,5-difluorophenyl)-(4-methylcyclohexyl)methanone (PubChem CID 55120292) has the molecular formula C14H16F2O and a molecular weight of 238.28 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(4-methylcyclohexyl)methanone.
| Compound Name | (2,5-difluorophenyl)-(4-methylcyclohexyl)methanone |
|---|---|
| PubChem CID | 55120292 |
| Molecular Formula | C14H16F2O |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2,5-difluorophenyl)-(4-methylcyclohexyl)methanone |
| SMILES | CC1CCC(C(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C14H16F2O/c1-9-2-4-10(5-3-9)14(17)12-8-11(15)6-7-13(12)16/h6-10H,2-5H2,1H3 |
| InChIKey | QIMZWUCMVWKURT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |