C14H17F2NO — CID 43219785
1-(2,5-difluorophenyl)-2-(4-methylpiperidin-1-yl)ethanone (PubChem CID 43219785) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-(4-methylpiperidin-1-yl)ethanone.
| Compound Name | 1-(2,5-difluorophenyl)-2-(4-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 43219785 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-(4-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCN(CC(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C14H17F2NO/c1-10-4-6-17(7-5-10)9-14(18)12-8-11(15)2-3-13(12)16/h2-3,8,10H,4-7,9H2,1H3 |
| InChIKey | VTNGHSALRLQUCY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |