C13H16F2N2O — CID 62029010
2-(4-aminopiperidin-1-yl)-1-(2,4-difluorophenyl)ethanone (PubChem CID 62029010) has the molecular formula C13H16F2N2O and a molecular weight of 254.28 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-1-(2,4-difluorophenyl)ethanone.
| Compound Name | 2-(4-aminopiperidin-1-yl)-1-(2,4-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 62029010 |
| Molecular Formula | C13H16F2N2O |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-1-(2,4-difluorophenyl)ethanone |
| SMILES | NC1CCN(CC(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C13H16F2N2O/c14-9-1-2-11(12(15)7-9)13(18)8-17-5-3-10(16)4-6-17/h1-2,7,10H,3-6,8,16H2 |
| InChIKey | LZFOPAIEZQWADM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |