C17H23F2NO — CID 62091099
2-(4-tert-butylpiperidin-1-yl)-1-(2,4-difluorophenyl)ethanone (PubChem CID 62091099) has the molecular formula C17H23F2NO and a molecular weight of 295.37 g/mol. Its IUPAC name is 2-(4-tert-butylpiperidin-1-yl)-1-(2,4-difluorophenyl)ethanone.
| Compound Name | 2-(4-tert-butylpiperidin-1-yl)-1-(2,4-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 62091099 |
| Molecular Formula | C17H23F2NO |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 2-(4-tert-butylpiperidin-1-yl)-1-(2,4-difluorophenyl)ethanone |
| SMILES | CC(C)(C)C1CCN(CC(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C17H23F2NO/c1-17(2,3)12-6-8-20(9-7-12)11-16(21)14-5-4-13(18)10-15(14)19/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | IUUHCDPZHQNAHL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |