C14H14F2N2O3 — CID 62017862
1-[2-(2,4-difluorophenyl)-2-oxoethyl]-4-ethylpiperazine-2,3-dione (PubChem CID 62017862) has the molecular formula C14H14F2N2O3 and a molecular weight of 296.27 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenyl)-2-oxoethyl]-4-ethylpiperazine-2,3-dione.
| Compound Name | 1-[2-(2,4-difluorophenyl)-2-oxoethyl]-4-ethylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 62017862 |
| Molecular Formula | C14H14F2N2O3 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-[2-(2,4-difluorophenyl)-2-oxoethyl]-4-ethylpiperazine-2,3-dione |
| SMILES | CCN1CCN(CC(=O)c2ccc(F)cc2F)C(=O)C1=O |
| InChI | InChI=1S/C14H14F2N2O3/c1-2-17-5-6-18(14(21)13(17)20)8-12(19)10-4-3-9(15)7-11(10)16/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | ZUQKAXDCXXZUST-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|