C12H13F2NO2 — CID 62942450
1-(2,4-difluorophenyl)-2-(3-hydroxypyrrolidin-1-yl)ethanone (PubChem CID 62942450) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(3-hydroxypyrrolidin-1-yl)ethanone.
| Compound Name | 1-(2,4-difluorophenyl)-2-(3-hydroxypyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 62942450 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(3-hydroxypyrrolidin-1-yl)ethanone |
| SMILES | O=C(CN1CCC(O)C1)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H13F2NO2/c13-8-1-2-10(11(14)5-8)12(17)7-15-4-3-9(16)6-15/h1-2,5,9,16H,3-4,6-7H2 |
| InChIKey | GWVNZZKXKUYRFR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |