C11H8F2N2O — CID 21253998
1-(2,4-difluorophenyl)-2-pyrazol-1-ylethanone (PubChem CID 21253998) has the molecular formula C11H8F2N2O and a molecular weight of 222.19 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-pyrazol-1-ylethanone.
| Compound Name | 1-(2,4-difluorophenyl)-2-pyrazol-1-ylethanone |
|---|---|
| PubChem CID | 21253998 |
| Molecular Formula | C11H8F2N2O |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-pyrazol-1-ylethanone |
| SMILES | O=C(Cn1cccn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H8F2N2O/c12-8-2-3-9(10(13)6-8)11(16)7-15-5-1-4-14-15/h1-6H,7H2 |
| InChIKey | DSDRAJORYAYJKJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |