C13H13ClF2N2O — CID 87585429
1-(2,4-difluorophenyl)-2-(2,3-dimethylimidazol-3-ium-1-yl)ethanone chloride (PubChem CID 87585429) has the molecular formula C13H13ClF2N2O and a molecular weight of 286.71 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(2,3-dimethylimidazol-3-ium-1-yl)ethanone chloride.
| Compound Name | 1-(2,4-difluorophenyl)-2-(2,3-dimethylimidazol-3-ium-1-yl)ethanone chloride |
|---|---|
| PubChem CID | 87585429 |
| Molecular Formula | C13H13ClF2N2O |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(2,3-dimethylimidazol-3-ium-1-yl)ethanone chloride |
| SMILES | Cc1n(CC(=O)c2ccc(F)cc2F)cc[n+]1C.[Cl-] |
| InChI | InChI=1S/C13H13F2N2O.ClH/c1-9-16(2)5-6-17(9)8-13(18)11-4-3-10(14)7-12(11)15;/h3-7H,8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | TUOKUGPVOIVCTN-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|