C12H8F2N2O — CID 18956540
1-(2,4-difluorophenyl)-2-pyridazin-3-ylethanone (PubChem CID 18956540) has the molecular formula C12H8F2N2O and a molecular weight of 234.21 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-pyridazin-3-ylethanone.
| Compound Name | 1-(2,4-difluorophenyl)-2-pyridazin-3-ylethanone |
|---|---|
| PubChem CID | 18956540 |
| Molecular Formula | C12H8F2N2O |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-pyridazin-3-ylethanone |
| SMILES | O=C(Cc1cccnn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H8F2N2O/c13-8-3-4-10(11(14)6-8)12(17)7-9-2-1-5-15-16-9/h1-6H,7H2 |
| InChIKey | LYHYUXYLUNLZMW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |