C14H9F2IO — CID 65478906
1-(2,4-difluorophenyl)-2-(4-iodophenyl)ethanone (PubChem CID 65478906) has the molecular formula C14H9F2IO and a molecular weight of 358.13 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(4-iodophenyl)ethanone.
| Compound Name | 1-(2,4-difluorophenyl)-2-(4-iodophenyl)ethanone |
|---|---|
| PubChem CID | 65478906 |
| Molecular Formula | C14H9F2IO |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(4-iodophenyl)ethanone |
| SMILES | O=C(Cc1ccc(I)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H9F2IO/c15-10-3-6-12(13(16)8-10)14(18)7-9-1-4-11(17)5-2-9/h1-6,8H,7H2 |
| InChIKey | RNPJGYVZDMATQK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|