C15H11F2IO — CID 65476457
1-(3,5-difluorophenyl)-3-(4-iodophenyl)propan-2-one (PubChem CID 65476457) has the molecular formula C15H11F2IO and a molecular weight of 372.15 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-(4-iodophenyl)propan-2-one.
| Compound Name | 1-(3,5-difluorophenyl)-3-(4-iodophenyl)propan-2-one |
|---|---|
| PubChem CID | 65476457 |
| Molecular Formula | C15H11F2IO |
| Molecular Weight | 372.15 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-(4-iodophenyl)propan-2-one |
| SMILES | O=C(Cc1ccc(I)cc1)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H11F2IO/c16-12-5-11(6-13(17)9-12)8-15(19)7-10-1-3-14(18)4-2-10/h1-6,9H,7-8H2 |
| InChIKey | FSJVAQNXZHKUGK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.15 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|