C15H13F2NO — CID 105411862
1-(4-aminophenyl)-3-(3,5-difluorophenyl)propan-2-one (PubChem CID 105411862) has the molecular formula C15H13F2NO and a molecular weight of 261.27 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-(3,5-difluorophenyl)propan-2-one.
| Compound Name | 1-(4-aminophenyl)-3-(3,5-difluorophenyl)propan-2-one |
|---|---|
| PubChem CID | 105411862 |
| Molecular Formula | C15H13F2NO |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-(4-aminophenyl)-3-(3,5-difluorophenyl)propan-2-one |
| SMILES | Nc1ccc(CC(=O)Cc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C15H13F2NO/c16-12-5-11(6-13(17)9-12)8-15(19)7-10-1-3-14(18)4-2-10/h1-6,9H,7-8,18H2 |
| InChIKey | JQAWDSUZMKKHLJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|