C16H15F2NO2 — CID 105407572
(3,5-difluorophenyl)methyl 3-(4-aminophenyl)propanoate (PubChem CID 105407572) has the molecular formula C16H15F2NO2 and a molecular weight of 291.30 g/mol. Its IUPAC name is (3,5-difluorophenyl)methyl 3-(4-aminophenyl)propanoate.
| Compound Name | (3,5-difluorophenyl)methyl 3-(4-aminophenyl)propanoate |
|---|---|
| PubChem CID | 105407572 |
| Molecular Formula | C16H15F2NO2 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (3,5-difluorophenyl)methyl 3-(4-aminophenyl)propanoate |
| SMILES | Nc1ccc(CCC(=O)OCc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C16H15F2NO2/c17-13-7-12(8-14(18)9-13)10-21-16(20)6-3-11-1-4-15(19)5-2-11/h1-2,4-5,7-9H,3,6,10,19H2 |
| InChIKey | ZKWIVJJHGRWOJH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|