C13H10F2N2O2 — CID 105407614
(3,5-difluorophenyl)methyl 5-aminopyridine-2-carboxylate (PubChem CID 105407614) has the molecular formula C13H10F2N2O2 and a molecular weight of 264.23 g/mol. Its IUPAC name is (3,5-difluorophenyl)methyl 5-aminopyridine-2-carboxylate.
| Compound Name | (3,5-difluorophenyl)methyl 5-aminopyridine-2-carboxylate |
|---|---|
| PubChem CID | 105407614 |
| Molecular Formula | C13H10F2N2O2 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (3,5-difluorophenyl)methyl 5-aminopyridine-2-carboxylate |
| SMILES | Nc1ccc(C(=O)OCc2cc(F)cc(F)c2)nc1 |
| InChI | InChI=1S/C13H10F2N2O2/c14-9-3-8(4-10(15)5-9)7-19-13(18)12-2-1-11(16)6-17-12/h1-6H,7,16H2 |
| InChIKey | YJIXOHNAOUPREG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |