C16H16N2O2 — CID 81315987
2,3-dihydro-1H-inden-5-ylmethyl 5-aminopyridine-2-carboxylate (PubChem CID 81315987) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-ylmethyl 5-aminopyridine-2-carboxylate.
| Compound Name | 2,3-dihydro-1H-inden-5-ylmethyl 5-aminopyridine-2-carboxylate |
|---|---|
| PubChem CID | 81315987 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-ylmethyl 5-aminopyridine-2-carboxylate |
| SMILES | Nc1ccc(C(=O)OCc2ccc3c(c2)CCC3)nc1 |
| InChI | InChI=1S/C16H16N2O2/c17-14-6-7-15(18-9-14)16(19)20-10-11-4-5-12-2-1-3-13(12)8-11/h4-9H,1-3,10,17H2 |
| InChIKey | FZRKHTATKAZVNI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |