C17H18N2O2 — CID 106956274
5-amino-2-(2,3-dihydro-1H-inden-5-ylmethoxy)benzamide (PubChem CID 106956274) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 5-amino-2-(2,3-dihydro-1H-inden-5-ylmethoxy)benzamide.
| Compound Name | 5-amino-2-(2,3-dihydro-1H-inden-5-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 106956274 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 5-amino-2-(2,3-dihydro-1H-inden-5-ylmethoxy)benzamide |
| SMILES | NC(=O)c1cc(N)ccc1OCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H18N2O2/c18-14-6-7-16(15(9-14)17(19)20)21-10-11-4-5-12-2-1-3-13(12)8-11/h4-9H,1-3,10,18H2,(H2,19,20) |
| InChIKey | AGRQDZQJBBFEPG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|