C18H18O3 — CID 80722668
2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)phenyl]acetic acid (PubChem CID 80722668) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)phenyl]acetic acid.
| Compound Name | 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 80722668 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-[2-(2,3-dihydro-1H-inden-5-ylmethoxy)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1OCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H18O3/c19-18(20)11-16-4-1-2-7-17(16)21-12-13-8-9-14-5-3-6-15(14)10-13/h1-2,4,7-10H,3,5-6,11-12H2,(H,19,20) |
| InChIKey | XIDQKICYYMQKKJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |