C23H20O3 — CID 155520617
4-[(6-phenyl-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid (PubChem CID 155520617) has the molecular formula C23H20O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is 4-[(6-phenyl-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid.
| Compound Name | 4-[(6-phenyl-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 155520617 |
| Molecular Formula | C23H20O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-[(6-phenyl-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2cc3c(cc2-c2ccccc2)CCC3)cc1 |
| InChI | InChI=1S/C23H20O3/c24-23(25)18-11-9-16(10-12-18)15-26-22-14-20-8-4-7-19(20)13-21(22)17-5-2-1-3-6-17/h1-3,5-6,9-14H,4,7-8,15H2,(H,24,25) |
| InChIKey | IQAYHPJNQXWKTD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |