C27H25NO5 — CID 1312680
4-[[2-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)phenoxy]methyl]benzoic acid (PubChem CID 1312680) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 4-[[2-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 1312680 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 4-[[2-(1,8-dioxo-2,3,4,5,6,7,9,10-octahydroacridin-9-yl)phenoxy]methyl]benzoic acid |
| SMILES | O=C1CCCC2=C1C(c1ccccc1OCc1ccc(C(=O)O)cc1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C27H25NO5/c29-21-8-3-6-19-25(21)24(26-20(28-19)7-4-9-22(26)30)18-5-1-2-10-23(18)33-15-16-11-13-17(14-12-16)27(31)32/h1-2,5,10-14,24,28H,3-4,6-9,15H2,(H,31,32) |
| InChIKey | COBJUWHNFWGCNS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |