C23H27NO3 — CID 2990703
9-(2-butoxyphenyl)-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione (PubChem CID 2990703) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 9-(2-butoxyphenyl)-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione.
| Compound Name | 9-(2-butoxyphenyl)-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 2990703 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 9-(2-butoxyphenyl)-2,3,4,5,6,7,9,10-octahydroacridine-1,8-dione |
| SMILES | CCCCOc1ccccc1C1C2=C(CCCC2=O)NC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C23H27NO3/c1-2-3-14-27-20-13-5-4-8-15(20)21-22-16(9-6-11-18(22)25)24-17-10-7-12-19(26)23(17)21/h4-5,8,13,21,24H,2-3,6-7,9-12,14H2,1H3 |
| InChIKey | GOVOVYYHLVKGMS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|