C26H35NO4 — CID 7089038
pentyl (4S)-4-(2-butoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7089038) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is pentyl (4S)-4-(2-butoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | pentyl (4S)-4-(2-butoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7089038 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | pentyl (4S)-4-(2-butoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCCCCOC(=O)C1C(C)=NC2=C(C(=O)CCC2)[C@@H]1c1ccccc1OCCCC |
| InChI | InChI=1S/C26H35NO4/c1-4-6-10-17-31-26(29)23-18(3)27-20-13-11-14-21(28)25(20)24(23)19-12-8-9-15-22(19)30-16-7-5-2/h8-9,12,15,23-24H,4-7,10-11,13-14,16-17H2,1-3H3/t23?,24-/m1/s1 |
| InChIKey | RTGONGMNDDFKED-XMMISQBUSA-N |
| XLogP | 5.78 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|