C23H29NO5 — CID 7087287
butyl (4R)-4-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7087287) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is butyl (4R)-4-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | butyl (4R)-4-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7087287 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | butyl (4R)-4-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCCCOC(=O)C1C(C)=NC2=C(C(=O)CCC2)[C@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H29NO5/c1-5-6-12-29-23(26)20-14(2)24-16-8-7-9-17(25)22(16)21(20)15-10-11-18(27-3)19(13-15)28-4/h10-11,13,20-21H,5-9,12H2,1-4H3/t20?,21-/m0/s1 |
| InChIKey | LBUBDDZMVDKQTE-LBAQZLPGSA-N |
| XLogP | 4.23 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|