C28H39NO5 — CID 7089320
pentyl (4S)-4-(3-methoxy-4-propoxyphenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 7089320) has the molecular formula C28H39NO5 and a molecular weight of 469.62 g/mol. Its IUPAC name is pentyl (4S)-4-(3-methoxy-4-propoxyphenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | pentyl (4S)-4-(3-methoxy-4-propoxyphenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7089320 |
| Molecular Formula | C28H39NO5 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | pentyl (4S)-4-(3-methoxy-4-propoxyphenyl)-2,7,7-trimethyl-5-oxo-3,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCCCCOC(=O)C1C(C)=NC2=C(C(=O)CC(C)(C)C2)[C@@H]1c1ccc(OCCC)c(OC)c1 |
| InChI | InChI=1S/C28H39NO5/c1-7-9-10-14-34-27(31)24-18(3)29-20-16-28(4,5)17-21(30)26(20)25(24)19-11-12-22(33-13-8-2)23(15-19)32-6/h11-12,15,24-25H,7-10,13-14,16-17H2,1-6H3/t24?,25-/m1/s1 |
| InChIKey | OIBOIOWOHSLIME-WUBHUQEYSA-N |
| XLogP | 6.03 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|