C30H35NO5S — CID 7898205
butyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylsulfanylphenyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7898205) has the molecular formula C30H35NO5S and a molecular weight of 521.68 g/mol. Its IUPAC name is butyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylsulfanylphenyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | butyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylsulfanylphenyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7898205 |
| Molecular Formula | C30H35NO5S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | butyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylsulfanylphenyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCCCOC(=O)C1C(C)=NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1ccc(SC)cc1 |
| InChI | InChI=1S/C30H35NO5S/c1-6-7-14-36-30(33)27-18(2)31-23-15-21(20-10-13-25(34-3)26(17-20)35-4)16-24(32)29(23)28(27)19-8-11-22(37-5)12-9-19/h8-13,17,21,27-28H,6-7,14-16H2,1-5H3/t21-,27?,28-/m1/s1 |
| InChIKey | PRFCQUKZVJXMHA-ZPJOZCPBSA-N |
| XLogP | 6.34 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|