C26H29NO5S — CID 7902467
propyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7902467) has the molecular formula C26H29NO5S and a molecular weight of 467.59 g/mol. Its IUPAC name is propyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | propyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7902467 |
| Molecular Formula | C26H29NO5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | propyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCCOC(=O)C1C(C)=NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C26H29NO5S/c1-5-10-32-26(29)23-15(2)27-18-12-17(16-8-9-20(30-3)21(14-16)31-4)13-19(28)24(18)25(23)22-7-6-11-33-22/h6-9,11,14,17,23,25H,5,10,12-13H2,1-4H3/t17-,23?,25+/m0/s1 |
| InChIKey | WFHURQKUCXEEKO-PBGLVDLSSA-N |
| XLogP | 5.29 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |