C35H37NO6 — CID 7902525
propyl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7902525) has the molecular formula C35H37NO6 and a molecular weight of 567.68 g/mol. Its IUPAC name is propyl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | propyl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7902525 |
| Molecular Formula | C35H37NO6 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | propyl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCCOC(=O)C1C(C)=NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@H]1c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H37NO6/c1-5-17-41-35(38)32-22(2)36-27-18-25(24-15-16-30(39-3)31(20-24)40-4)19-28(37)34(27)33(32)26-13-9-10-14-29(26)42-21-23-11-7-6-8-12-23/h6-16,20,25,32-33H,5,17-19,21H2,1-4H3/t25-,32?,33+/m1/s1 |
| InChIKey | XZKIEGYDHILIKU-KOHXGEHSSA-N |
| XLogP | 6.81 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |