C30H35NO6S — CID 7910181
2-ethylsulfanylethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7910181) has the molecular formula C30H35NO6S and a molecular weight of 537.68 g/mol. Its IUPAC name is 2-ethylsulfanylethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | 2-ethylsulfanylethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7910181 |
| Molecular Formula | C30H35NO6S |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | 2-ethylsulfanylethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-4-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCSCCOC(=O)C1C(C)=NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1ccccc1OC |
| InChI | InChI=1S/C30H35NO6S/c1-6-38-14-13-37-30(33)27-18(2)31-22-15-20(19-11-12-25(35-4)26(17-19)36-5)16-23(32)29(22)28(27)21-9-7-8-10-24(21)34-3/h7-12,17,20,27-28H,6,13-16H2,1-5H3/t20-,27?,28+/m0/s1 |
| InChIKey | YYNKQQJNIRJKES-KGPOJSBJSA-N |
| XLogP | 5.58 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|