C30H35NO5S — CID 7910191
2-ethylsulfanylethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7910191) has the molecular formula C30H35NO5S and a molecular weight of 521.68 g/mol. Its IUPAC name is 2-ethylsulfanylethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | 2-ethylsulfanylethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7910191 |
| Molecular Formula | C30H35NO5S |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 2-ethylsulfanylethyl (4R,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(4-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCSCCOC(=O)C1C(C)=NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C30H35NO5S/c1-6-37-14-13-36-30(33)27-19(3)31-23-15-22(21-11-12-25(34-4)26(17-21)35-5)16-24(32)29(23)28(27)20-9-7-18(2)8-10-20/h7-12,17,22,27-28H,6,13-16H2,1-5H3/t22-,27?,28-/m0/s1 |
| InChIKey | IVSLPJFWFPVNOG-XFFXTOGMSA-N |
| XLogP | 5.88 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|