C36H39NO7 — CID 7909882
2-ethoxyethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7909882) has the molecular formula C36H39NO7 and a molecular weight of 597.71 g/mol. Its IUPAC name is 2-ethoxyethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | 2-ethoxyethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7909882 |
| Molecular Formula | C36H39NO7 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | 2-ethoxyethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(2-phenylmethoxyphenyl)-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCOCCOC(=O)C1C(C)=NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H39NO7/c1-5-42-17-18-43-36(39)33-23(2)37-28-19-26(25-15-16-31(40-3)32(21-25)41-4)20-29(38)35(28)34(33)27-13-9-10-14-30(27)44-22-24-11-7-6-8-12-24/h6-16,21,26,33-34H,5,17-20,22H2,1-4H3/t26-,33?,34-/m1/s1 |
| InChIKey | GDZRMTPTQQZMRT-OPVIFPROSA-N |
| XLogP | 6.44 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|