C31H37NO8 — CID 7909846
2-ethoxyethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7909846) has the molecular formula C31H37NO8 and a molecular weight of 551.64 g/mol. Its IUPAC name is 2-ethoxyethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | 2-ethoxyethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7909846 |
| Molecular Formula | C31H37NO8 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 2-ethoxyethyl (4S,7R)-7-(3,4-dimethoxyphenyl)-4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCOCCOC(=O)C1C(C)=NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1ccc(O)c(OCC)c1 |
| InChI | InChI=1S/C31H37NO8/c1-6-38-12-13-40-31(35)28-18(3)32-22-14-21(19-9-11-25(36-4)27(16-19)37-5)15-24(34)30(22)29(28)20-8-10-23(33)26(17-20)39-7-2/h8-11,16-17,21,28-29,33H,6-7,12-15H2,1-5H3/t21-,28?,29-/m1/s1 |
| InChIKey | JXFYIVJJDXIVKG-ZYPQEODYSA-N |
| XLogP | 4.96 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|